C16H16ClFNO4P — CID 138503981
(2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(4-fluorophenyl)-2-methylpropanoic acid (PubChem CID 138503981) has the molecular formula C16H16ClFNO4P and a molecular weight of 371.73 g/mol. Its IUPAC name is (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(4-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(4-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 138503981 |
| Molecular Formula | C16H16ClFNO4P |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | (2R)-2-[[chloro(phenoxy)phosphoryl]amino]-3-(4-fluorophenyl)-2-methylpropanoic acid |
| SMILES | C[C@](Cc1ccc(F)cc1)(NP(=O)(Cl)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H16ClFNO4P/c1-16(15(20)21,11-12-7-9-13(18)10-8-12)19-24(17,22)23-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,19,22)(H,20,21)/t16-,24?/m1/s1 |
| InChIKey | CQCCMOVADSMHGE-YAOANENCSA-N |
| XLogP | 4.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|