C23H26FNO5P+ — CID 67715207
[3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6-methyl-2-(6-propan-2-yl-2-pyridinyl)hept-4-yn-3-yl]-hydroxy-oxophosphanium (PubChem CID 67715207) has the molecular formula C23H26FNO5P+ and a molecular weight of 446.44 g/mol. Its IUPAC name is [3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6-methyl-2-(6-propan-2-yl-2-pyridinyl)hept-4-yn-3-yl]-hydroxy-oxophosphanium.
| Compound Name | [3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6-methyl-2-(6-propan-2-yl-2-pyridinyl)hept-4-yn-3-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67715207 |
| Molecular Formula | C23H26FNO5P+ |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6-methyl-2-(6-propan-2-yl-2-pyridinyl)hept-4-yn-3-yl]-hydroxy-oxophosphanium |
| SMILES | CC(C)C#CC(C(=O)O)([P+](=O)O)C(O)(Cc1ccc(F)cc1)c1cccc(C(C)C)n1 |
| InChI | InChI=1S/C23H25FNO5P/c1-15(2)12-13-23(21(26)27,31(29)30)22(28,14-17-8-10-18(24)11-9-17)20-7-5-6-19(25-20)16(3)4/h5-11,15-16,28H,14H2,1-4H3,(H-,26,27,29,30)/p+1 |
| InChIKey | GEPSXVIUIGJWQS-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|