C28H28FNO5P+ — CID 67715039
[3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6,6-dimethyl-2-(6-phenyl-2-pyridinyl)hept-4-yn-3-yl]-methoxy-oxophosphanium (PubChem CID 67715039) has the molecular formula C28H28FNO5P+ and a molecular weight of 508.51 g/mol. Its IUPAC name is [3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6,6-dimethyl-2-(6-phenyl-2-pyridinyl)hept-4-yn-3-yl]-methoxy-oxophosphanium.
| Compound Name | [3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6,6-dimethyl-2-(6-phenyl-2-pyridinyl)hept-4-yn-3-yl]-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 67715039 |
| Molecular Formula | C28H28FNO5P+ |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [3-carboxy-1-(4-fluorophenyl)-2-hydroxy-6,6-dimethyl-2-(6-phenyl-2-pyridinyl)hept-4-yn-3-yl]-methoxy-oxophosphanium |
| SMILES | CO[P+](=O)C(C#CC(C)(C)C)(C(=O)O)C(O)(Cc1ccc(F)cc1)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H27FNO5P/c1-26(2,3)17-18-28(25(31)32,36(34)35-4)27(33,19-20-13-15-22(29)16-14-20)24-12-8-11-23(30-24)21-9-6-5-7-10-21/h5-16,33H,19H2,1-4H3/p+1 |
| InChIKey | IKMGREQMBLWTSM-UHFFFAOYSA-O |
| XLogP | 5.58 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|