C9H17N3S — CID 173328444
methyl 2-amino-N-cyano-4,4-dimethylpentanimidothioate (PubChem CID 173328444) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is methyl 2-amino-N-cyano-4,4-dimethylpentanimidothioate.
| Compound Name | methyl 2-amino-N-cyano-4,4-dimethylpentanimidothioate |
|---|---|
| PubChem CID | 173328444 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | methyl 2-amino-N-cyano-4,4-dimethylpentanimidothioate |
| SMILES | CS/C(=N\C#N)C(N)CC(C)(C)C |
| InChI | InChI=1S/C9H17N3S/c1-9(2,3)5-7(11)8(13-4)12-6-10/h7H,5,11H2,1-4H3/b12-8- |
| InChIKey | WBSBFBYOAPDCFJ-WQLSENKSSA-N |
| XLogP | 1.99 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|