About 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid
7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid (PubChem CID 173328533) has the molecular formula C17H14O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid.
Molecular Properties
| Compound Name | 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid |
| PubChem CID | 173328533 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid |
| SMILES | CC1COc2c(C(=O)c3ccccc3)ccc(C(=O)O)c21 |
| InChI | InChI=1S/C17H14O4/c1-10-9-21-16-13(8-7-12(14(10)16)17(19)20)15(18)11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,19,20) |
| InChIKey | KKJQBUWQUJZAMU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid?
The IUPAC name of 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid (CID 173328533) is 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid.
What is the SMILES notation for 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid?
The canonical SMILES for 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid is CC1COc2c(C(=O)c3ccccc3)ccc(C(=O)O)c21.
What is the InChIKey of 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid?
The InChIKey is KKJQBUWQUJZAMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O4/c1-10-9-21-16-13(8-7-12(14(10)16)17(19)20)15(18)11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,19,20).
What are the key properties of 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid?
7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid has a molecular weight of 282.30 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzoyl-3-methyl-2,3-dihydro-1-benzofuran-4-carboxylic acid is sourced from PubChem (CID 173328533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).