C19H34O5Si — CID 173329049
[4-[3-(2-methylprop-2-enoyloxy)propyl]-5-silyloxyoctyl] 2-methylprop-2-enoate (PubChem CID 173329049) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [4-[3-(2-methylprop-2-enoyloxy)propyl]-5-silyloxyoctyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3-(2-methylprop-2-enoyloxy)propyl]-5-silyloxyoctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173329049 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [4-[3-(2-methylprop-2-enoyloxy)propyl]-5-silyloxyoctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCOC(=O)C(=C)C)C(CCC)O[SiH3] |
| InChI | InChI=1S/C19H34O5Si/c1-6-9-17(24-25)16(10-7-12-22-18(20)14(2)3)11-8-13-23-19(21)15(4)5/h16-17H,2,4,6-13H2,1,3,5,25H3 |
| InChIKey | GGDCKNZTJBJDAB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|