C34H44O6 — CID 173329712
dimethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 173329712) has the molecular formula C34H44O6 and a molecular weight of 548.72 g/mol. Its IUPAC name is dimethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 173329712 |
| Molecular Formula | C34H44O6 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | dimethyl (4R,5R)-2-[2-(1-pentyl-4-phenylcyclohexyl)but-3-enyl]-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C=CC(CC1(c2ccccc2)O[C@@H](C(=O)OC)[C@H](C(=O)OC)O1)C1(CCCCC)CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C34H44O6/c1-5-7-14-21-33(22-19-26(20-23-33)25-15-10-8-11-16-25)27(6-2)24-34(28-17-12-9-13-18-28)39-29(31(35)37-3)30(40-34)32(36)38-4/h6,8-13,15-18,26-27,29-30H,2,5,7,14,19-24H2,1,3-4H3/t26?,27?,29-,30-,33?/m1/s1 |
| InChIKey | YKDJKNPBSGHRDP-LMZIKWILSA-N |
| XLogP | 7.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|