C54H50F12N4O8 — CID 173329831
bis(2-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]acetamide);oxalic acid (PubChem CID 173329831) has the molecular formula C54H50F12N4O8 and a molecular weight of 1110.99 g/mol. Its IUPAC name is bis(2-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]acetamide);oxalic acid.
| Compound Name | bis(2-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]acetamide);oxalic acid |
|---|---|
| PubChem CID | 173329831 |
| Molecular Formula | C54H50F12N4O8 |
| Molecular Weight | 1110.99 g/mol |
| Exact Mass | 1110.34 |
| IUPAC Name | bis(2-amino-N-[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]acetamide);oxalic acid |
| SMILES | NCC(=O)NC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(c1ccccc1)c1ccccc1.NCC(=O)NC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(c1ccccc1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C26H24F6N2O2.C2H2O4/c2*27-25(28,29)20-11-17(12-21(13-20)26(30,31)32)15-36-16-22(34-23(35)14-33)24(18-7-3-1-4-8-18)19-9-5-2-6-10-19;3-1(4)2(5)6/h2*1-13,22,24H,14-16,33H2,(H,34,35);(H,3,4)(H,5,6) |
| InChIKey | GAMGLNPVWYHPPJ-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 203.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.99 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|