C19H21NaO7S — CID 173330731
sodium;2-(1,1-diphenylpropyl)-2-sulfobutanedioic acid;hydride (PubChem CID 173330731) has the molecular formula C19H21NaO7S and a molecular weight of 416.43 g/mol. Its IUPAC name is sodium;2-(1,1-diphenylpropyl)-2-sulfobutanedioic acid;hydride.
| Compound Name | sodium;2-(1,1-diphenylpropyl)-2-sulfobutanedioic acid;hydride |
|---|---|
| PubChem CID | 173330731 |
| Molecular Formula | C19H21NaO7S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | sodium;2-(1,1-diphenylpropyl)-2-sulfobutanedioic acid;hydride |
| SMILES | CCC(c1ccccc1)(c1ccccc1)C(CC(=O)O)(C(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C19H20O7S.Na.H/c1-2-18(14-9-5-3-6-10-14,15-11-7-4-8-12-15)19(17(22)23,13-16(20)21)27(24,25)26;;/h3-12H,2,13H2,1H3,(H,20,21)(H,22,23)(H,24,25,26);;/q;+1;-1 |
| InChIKey | FXKPVWDVALYRFN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|