C15H21NaO7S — CID 175544450
sodium;hydride;2-(3-phenylpentan-3-yl)-2-sulfobutanedioic acid (PubChem CID 175544450) has the molecular formula C15H21NaO7S and a molecular weight of 368.38 g/mol. Its IUPAC name is sodium;hydride;2-(3-phenylpentan-3-yl)-2-sulfobutanedioic acid.
| Compound Name | sodium;hydride;2-(3-phenylpentan-3-yl)-2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 175544450 |
| Molecular Formula | C15H21NaO7S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | sodium;hydride;2-(3-phenylpentan-3-yl)-2-sulfobutanedioic acid |
| SMILES | CCC(CC)(c1ccccc1)C(CC(=O)O)(C(=O)O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C15H20O7S.Na.H/c1-3-14(4-2,11-8-6-5-7-9-11)15(13(18)19,10-12(16)17)23(20,21)22;;/h5-9H,3-4,10H2,1-2H3,(H,16,17)(H,18,19)(H,20,21,22);;/q;+1;-1 |
| InChIKey | ZKRSUHZEHQUAOW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|