C25H30N3O4+ — CID 173332529
acetyl-aminooxy-[cyclohexyl-[4-(quinolin-2-ylmethoxy)phenyl]methyl]-hydroxyazanium (PubChem CID 173332529) has the molecular formula C25H30N3O4+ and a molecular weight of 436.53 g/mol. Its IUPAC name is acetyl-aminooxy-[cyclohexyl-[4-(quinolin-2-ylmethoxy)phenyl]methyl]-hydroxyazanium.
| Compound Name | acetyl-aminooxy-[cyclohexyl-[4-(quinolin-2-ylmethoxy)phenyl]methyl]-hydroxyazanium |
|---|---|
| PubChem CID | 173332529 |
| Molecular Formula | C25H30N3O4+ |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | acetyl-aminooxy-[cyclohexyl-[4-(quinolin-2-ylmethoxy)phenyl]methyl]-hydroxyazanium |
| SMILES | CC(=O)[N+](O)(ON)C(c1ccc(OCc2ccc3ccccc3n2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H30N3O4/c1-18(29)28(30,32-26)25(20-8-3-2-4-9-20)21-12-15-23(16-13-21)31-17-22-14-11-19-7-5-6-10-24(19)27-22/h5-7,10-16,20,25,30H,2-4,8-9,17,26H2,1H3/q+1 |
| InChIKey | PZYZWMNJPVGJSG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|