C26H28N2O4 — CID 67719075
methyl N-[2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetyl]-N-methylcarbamate (PubChem CID 67719075) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl N-[2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetyl]-N-methylcarbamate.
| Compound Name | methyl N-[2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67719075 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl N-[2-cyclopentyl-2-[4-(quinolin-2-ylmethoxy)phenyl]acetyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C(=O)C(c1ccc(OCc2ccc3ccccc3n2)cc1)C1CCCC1 |
| InChI | InChI=1S/C26H28N2O4/c1-28(26(30)31-2)25(29)24(19-8-3-4-9-19)20-12-15-22(16-13-20)32-17-21-14-11-18-7-5-6-10-23(18)27-21/h5-7,10-16,19,24H,3-4,8-9,17H2,1-2H3 |
| InChIKey | PAAPUVMUCUGHKU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |