C24H26N2O5S — CID 67704199
2-[3-(methanesulfonamido)cyclopentyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid (PubChem CID 67704199) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[3-(methanesulfonamido)cyclopentyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid.
| Compound Name | 2-[3-(methanesulfonamido)cyclopentyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 67704199 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[3-(methanesulfonamido)cyclopentyl]-2-[4-(quinolin-2-ylmethoxy)phenyl]acetic acid |
| SMILES | CS(=O)(=O)NC1CCC(C(C(=O)O)c2ccc(OCc3ccc4ccccc4n3)cc2)C1 |
| InChI | InChI=1S/C24H26N2O5S/c1-32(29,30)26-19-10-7-18(14-19)23(24(27)28)17-8-12-21(13-9-17)31-15-20-11-6-16-4-2-3-5-22(16)25-20/h2-6,8-9,11-13,18-19,23,26H,7,10,14-15H2,1H3,(H,27,28) |
| InChIKey | VEAJKDOKPJFEOH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |