About (2S)-2-aminopropanoic acid;disilyloxysilane
(2S)-2-aminopropanoic acid;disilyloxysilane (PubChem CID 173332972) has the molecular formula C3H15NO4Si3
and a molecular weight of 213.41 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;disilyloxysilane.
Molecular Properties
| Compound Name | (2S)-2-aminopropanoic acid;disilyloxysilane |
| PubChem CID | 173332972 |
| Molecular Formula | C3H15NO4Si3 |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | (2S)-2-aminopropanoic acid;disilyloxysilane |
| SMILES | C[C@H](N)C(=O)O.[SiH3]O[SiH2]O[SiH3] |
| InChI | InChI=1S/C3H7NO2.H8O2Si3/c1-2(4)3(5)6;3-1-5-2-4/h2H,4H2,1H3,(H,5,6);5H2,3-4H3/t2-;/m0./s1 |
| InChIKey | BNQAWFPSZZVIOX-DKWTVANSSA-N |
| XLogP | -4.00 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopropanoic acid;disilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopropanoic acid;disilyloxysilane?
The IUPAC name of (2S)-2-aminopropanoic acid;disilyloxysilane (CID 173332972) is (2S)-2-aminopropanoic acid;disilyloxysilane.
What is the SMILES notation for (2S)-2-aminopropanoic acid;disilyloxysilane?
The canonical SMILES for (2S)-2-aminopropanoic acid;disilyloxysilane is C[C@H](N)C(=O)O.[SiH3]O[SiH2]O[SiH3].
What is the InChIKey of (2S)-2-aminopropanoic acid;disilyloxysilane?
The InChIKey is BNQAWFPSZZVIOX-DKWTVANSSA-N. The full InChI is InChI=1S/C3H7NO2.H8O2Si3/c1-2(4)3(5)6;3-1-5-2-4/h2H,4H2,1H3,(H,5,6);5H2,3-4H3/t2-;/m0./s1.
What are the key properties of (2S)-2-aminopropanoic acid;disilyloxysilane?
(2S)-2-aminopropanoic acid;disilyloxysilane has a molecular weight of 213.41 g/mol, XLogP of -4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopropanoic acid;disilyloxysilane is sourced from PubChem (CID 173332972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).