C21H21N6NaO7S — CID 173339023
sodium;hydride;(3S,6R,10R)-4-[(4-hydroxyphenyl)carbamoyl]-8-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)-sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid (PubChem CID 173339023) has the molecular formula C21H21N6NaO7S and a molecular weight of 524.49 g/mol. Its IUPAC name is sodium;hydride;(3S,6R,10R)-4-[(4-hydroxyphenyl)carbamoyl]-8-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)-sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid.
| Compound Name | sodium;hydride;(3S,6R,10R)-4-[(4-hydroxyphenyl)carbamoyl]-8-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)-sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
|---|---|
| PubChem CID | 173339023 |
| Molecular Formula | C21H21N6NaO7S |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | sodium;hydride;(3S,6R,10R)-4-[(4-hydroxyphenyl)carbamoyl]-8-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)-sulfanylmethyl]-2-oxo-1,4-diazatricyclo[4.3.1.03,10]dec-8-ene-9-carboxylic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1C(S)C1=C(C(=O)O)N2C(=O)[C@@H]3[C@H]2[C@H](C1)CN3C(=O)Nc1ccc(O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C21H20N6O7S.Na.H/c1-25-16(23-17(29)18(30)24-25)15(35)11-6-8-7-26(21(34)22-9-2-4-10(28)5-3-9)14-12(8)27(19(14)31)13(11)20(32)33;;/h2-5,8,12,14-15,28,35H,6-7H2,1H3,(H,22,34)(H,24,30)(H,32,33);;/q;+1;-1/t8-,12-,14+,15?;;/m1../s1 |
| InChIKey | LEVPHXQYAAALTK-VVVUBOLESA-N |
| XLogP | -3.25 |
| TPSA | 177.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|