C17H29NO3Si — CID 173345881
benzyl (2S)-2-(dimethylsilylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate (PubChem CID 173345881) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is benzyl (2S)-2-(dimethylsilylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate.
| Compound Name | benzyl (2S)-2-(dimethylsilylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate |
|---|---|
| PubChem CID | 173345881 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | benzyl (2S)-2-(dimethylsilylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate |
| SMILES | CC(OC(C)(C)C)[C@H](N[SiH](C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H29NO3Si/c1-13(21-17(2,3)4)15(18-22(5)6)16(19)20-12-14-10-8-7-9-11-14/h7-11,13,15,18,22H,12H2,1-6H3/t13?,15-/m0/s1 |
| InChIKey | LCPGBQPYEPZVDM-WUJWULDRSA-N |
| XLogP | 2.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|