C21H15N3O3S — CID 173346030
3-hydroxyimino-1-(2-oxo-2-thiophen-2-ylethyl)-5-phenyl-1,4-benzodiazepin-2-one (PubChem CID 173346030) has the molecular formula C21H15N3O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is 3-hydroxyimino-1-(2-oxo-2-thiophen-2-ylethyl)-5-phenyl-1,4-benzodiazepin-2-one.
| Compound Name | 3-hydroxyimino-1-(2-oxo-2-thiophen-2-ylethyl)-5-phenyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 173346030 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-hydroxyimino-1-(2-oxo-2-thiophen-2-ylethyl)-5-phenyl-1,4-benzodiazepin-2-one |
| SMILES | O=C(Cn1c(=O)c(=NO)nc(-c2ccccc2)c2ccccc21)c1cccs1 |
| InChI | InChI=1S/C21H15N3O3S/c25-17(18-11-6-12-28-18)13-24-16-10-5-4-9-15(16)19(14-7-2-1-3-8-14)22-20(23-27)21(24)26/h1-12,27H,13H2 |
| InChIKey | YXDYUDLPTAXLFN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|