C23H48NOP — CID 173346829
1-(trimethylazaniumyl)icos-11-en-2-yloxyphosphanide (PubChem CID 173346829) has the molecular formula C23H48NOP and a molecular weight of 385.62 g/mol. Its IUPAC name is 1-(trimethylazaniumyl)icos-11-en-2-yloxyphosphanide.
| Compound Name | 1-(trimethylazaniumyl)icos-11-en-2-yloxyphosphanide |
|---|---|
| PubChem CID | 173346829 |
| Molecular Formula | C23H48NOP |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.35 |
| IUPAC Name | 1-(trimethylazaniumyl)icos-11-en-2-yloxyphosphanide |
| SMILES | CCCCCCCCC=CCCCCCCCCC(C[N+](C)(C)C)O[PH-] |
| InChI | InChI=1S/C23H48NOP/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25-26)22-24(2,3)4/h12-13,23,26H,5-11,14-22H2,1-4H3 |
| InChIKey | FXRQNSVRJBQJHP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|