C9H6Cl2NNaO2 — CID 173348475
sodium;1,3-dichloroindole-2-carboxylic acid;hydride (PubChem CID 173348475) has the molecular formula C9H6Cl2NNaO2 and a molecular weight of 254.05 g/mol. Its IUPAC name is sodium;1,3-dichloroindole-2-carboxylic acid;hydride.
| Compound Name | sodium;1,3-dichloroindole-2-carboxylic acid;hydride |
|---|---|
| PubChem CID | 173348475 |
| Molecular Formula | C9H6Cl2NNaO2 |
| Molecular Weight | 254.05 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | sodium;1,3-dichloroindole-2-carboxylic acid;hydride |
| SMILES | O=C(O)c1c(Cl)c2ccccc2n1Cl.[H-].[Na+] |
| InChI | InChI=1S/C9H5Cl2NO2.Na.H/c10-7-5-3-1-2-4-6(5)12(11)8(7)9(13)14;;/h1-4H,(H,13,14);;/q;+1;-1 |
| InChIKey | SNQOZKCLWIIWSI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.05 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |