C22H35N3O4S — CID 173358384
N-[[(8S,9R,10R,13S,14S)-17-hydroxy-2-hydroxyimino-10,11,13,17-tetramethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-ylidene]amino]methanesulfonamide (PubChem CID 173358384) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is N-[[(8S,9R,10R,13S,14S)-17-hydroxy-2-hydroxyimino-10,11,13,17-tetramethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-ylidene]amino]methanesulfonamide.
| Compound Name | N-[[(8S,9R,10R,13S,14S)-17-hydroxy-2-hydroxyimino-10,11,13,17-tetramethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-ylidene]amino]methanesulfonamide |
|---|---|
| PubChem CID | 173358384 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N-[[(8S,9R,10R,13S,14S)-17-hydroxy-2-hydroxyimino-10,11,13,17-tetramethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-ylidene]amino]methanesulfonamide |
| SMILES | CC1C[C@@]2(C)[C@@H](CCC2(C)O)[C@@H]2CCC3=CC(=NNS(C)(=O)=O)C(=NO)C[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C22H35N3O4S/c1-13-11-21(3)16(8-9-22(21,4)26)15-7-6-14-10-17(23-25-30(5,28)29)18(24-27)12-20(14,2)19(13)15/h10,13,15-16,19,25-27H,6-9,11-12H2,1-5H3/t13?,15-,16-,19+,20-,21-,22?/m0/s1 |
| InChIKey | RCKCZVYHGLRCFO-XQRSHUJSSA-N |
| XLogP | 3.29 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|