C14H25NO4 — CID 173359095
(2S)-2-amino-3-cyclohexyl-4-formyloxy-2,4-dimethylpentanoic acid (PubChem CID 173359095) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclohexyl-4-formyloxy-2,4-dimethylpentanoic acid.
| Compound Name | (2S)-2-amino-3-cyclohexyl-4-formyloxy-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 173359095 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (2S)-2-amino-3-cyclohexyl-4-formyloxy-2,4-dimethylpentanoic acid |
| SMILES | CC(C)(OC=O)C(C1CCCCC1)[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C14H25NO4/c1-13(2,19-9-16)11(14(3,15)12(17)18)10-7-5-4-6-8-10/h9-11H,4-8,15H2,1-3H3,(H,17,18)/t11?,14-/m0/s1 |
| InChIKey | BEFIMZVOAQBEHP-IAXJKZSUSA-N |
| XLogP | 1.94 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|