C13H21NO3 — CID 173360557
(cyclohexylamino) (2E)-7-hydroxyhepta-2,4-dienoate (PubChem CID 173360557) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (cyclohexylamino) (2E)-7-hydroxyhepta-2,4-dienoate.
| Compound Name | (cyclohexylamino) (2E)-7-hydroxyhepta-2,4-dienoate |
|---|---|
| PubChem CID | 173360557 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (cyclohexylamino) (2E)-7-hydroxyhepta-2,4-dienoate |
| SMILES | O=C(/C=C/C=CCCO)ONC1CCCCC1 |
| InChI | InChI=1S/C13H21NO3/c15-11-7-2-1-6-10-13(16)17-14-12-8-4-3-5-9-12/h1-2,6,10,12,14-15H,3-5,7-9,11H2/b2-1?,10-6+ |
| InChIKey | GKJMDYGAOJZOSR-XHHHWAFGSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|