C14H17Cr- — CID 173362336
chromium;cyclohepta-1,3-diene;cyclohepta-1,3,5-triene (PubChem CID 173362336) has the molecular formula C14H17Cr- and a molecular weight of 237.29 g/mol. Its IUPAC name is chromium;cyclohepta-1,3-diene;cyclohepta-1,3,5-triene.
| Compound Name | chromium;cyclohepta-1,3-diene;cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 173362336 |
| Molecular Formula | C14H17Cr- |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | chromium;cyclohepta-1,3-diene;cyclohepta-1,3,5-triene |
| SMILES | C1=CCCCC=C1.[C-]1=CC=CC=CC1.[Cr] |
| InChI | InChI=1S/C7H10.C7H7.Cr/c2*1-2-4-6-7-5-3-1;/h1-4H,5-7H2;1-5H,6H2;/q;-1; |
| InChIKey | KCVVFRWUVUNWKY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|