C12H22N4O4 — CID 173363129
N,N'-bis(3-nitroprop-2-enyl)hexane-1,6-diamine (PubChem CID 173363129) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is N,N'-bis(3-nitroprop-2-enyl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(3-nitroprop-2-enyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 173363129 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | N,N'-bis(3-nitroprop-2-enyl)hexane-1,6-diamine |
| SMILES | O=[N+]([O-])C=CCNCCCCCCNCC=C[N+](=O)[O-] |
| InChI | InChI=1S/C12H22N4O4/c17-15(18)11-5-9-13-7-3-1-2-4-8-14-10-6-12-16(19)20/h5-6,11-14H,1-4,7-10H2 |
| InChIKey | QCBJSEKEPLLFAC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|