C5H6N2O4 — CID 174846180
1,5-dinitropenta-1,4-diene (PubChem CID 174846180) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 1,5-dinitropenta-1,4-diene.
| Compound Name | 1,5-dinitropenta-1,4-diene |
|---|---|
| PubChem CID | 174846180 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 1,5-dinitropenta-1,4-diene |
| SMILES | O=[N+]([O-])C=CCC=C[N+](=O)[O-] |
| InChI | InChI=1S/C5H6N2O4/c8-6(9)4-2-1-3-5-7(10)11/h2-5H,1H2 |
| InChIKey | CRRQWLGHJXAYBY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|