C8H15NO4 — CID 56957420
(E)-4,4-diethoxy-1-nitrobut-1-ene (PubChem CID 56957420) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (E)-4,4-diethoxy-1-nitrobut-1-ene.
| Compound Name | (E)-4,4-diethoxy-1-nitrobut-1-ene |
|---|---|
| PubChem CID | 56957420 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (E)-4,4-diethoxy-1-nitrobut-1-ene |
| SMILES | CCOC(C/C=C/[N+](=O)[O-])OCC |
| InChI | InChI=1S/C8H15NO4/c1-3-12-8(13-4-2)6-5-7-9(10)11/h5,7-8H,3-4,6H2,1-2H3/b7-5+ |
| InChIKey | GHGUSPQVPMXHRW-FNORWQNLSA-N |
| XLogP | 1.57 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|