C7H13NO4 — CID 141417973
(3S,5R)-1-nitrohept-1-ene-3,5-diol (PubChem CID 141417973) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is (3S,5R)-1-nitrohept-1-ene-3,5-diol.
| Compound Name | (3S,5R)-1-nitrohept-1-ene-3,5-diol |
|---|---|
| PubChem CID | 141417973 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (3S,5R)-1-nitrohept-1-ene-3,5-diol |
| SMILES | CC[C@@H](O)C[C@H](O)C=C[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO4/c1-2-6(9)5-7(10)3-4-8(11)12/h3-4,6-7,9-10H,2,5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | GAPSNQVMQSIJAL-RNFRBKRXSA-N |
| XLogP | 0.30 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|