C17H30 — CID 173364964
7,7-dimethylnona-3,8-dien-2-ylcyclohexane (PubChem CID 173364964) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 7,7-dimethylnona-3,8-dien-2-ylcyclohexane.
| Compound Name | 7,7-dimethylnona-3,8-dien-2-ylcyclohexane |
|---|---|
| PubChem CID | 173364964 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 7,7-dimethylnona-3,8-dien-2-ylcyclohexane |
| SMILES | C=CC(C)(C)CCC=CC(C)C1CCCCC1 |
| InChI | InChI=1S/C17H30/c1-5-17(3,4)14-10-9-11-15(2)16-12-7-6-8-13-16/h5,9,11,15-16H,1,6-8,10,12-14H2,2-4H3 |
| InChIKey | FBLQDQLHZDVHMJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|