C8H9N3O3 — CID 173365283
4-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridazine-3,6-dione (PubChem CID 173365283) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridazine-3,6-dione.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridazine-3,6-dione |
|---|---|
| PubChem CID | 173365283 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-1,2-dihydropyridazine-3,6-dione |
| SMILES | O=C1CCCN1c1cc(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C8H9N3O3/c12-6-4-5(8(14)10-9-6)11-3-1-2-7(11)13/h4H,1-3H2,(H,9,12)(H,10,14) |
| InChIKey | HQJMYYZWSKGNSR-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |