C10H13N3O3 — CID 60635018
2-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyridazine-3,6-dione (PubChem CID 60635018) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyridazine-3,6-dione.
| Compound Name | 2-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 60635018 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-pyridazine-3,6-dione |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)N1CCCC1 |
| InChI | InChI=1S/C10H13N3O3/c14-8-3-4-9(15)13(11-8)7-10(16)12-5-1-2-6-12/h3-4H,1-2,5-7H2,(H,11,14) |
| InChIKey | DTDSPOAGLFFGQV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |