C6H7N3O3 — CID 45089030
2-(2,5-dioxopyrrol-1-yl)acetohydrazide (PubChem CID 45089030) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)acetohydrazide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 45089030 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H7N3O3/c7-8-4(10)3-9-5(11)1-2-6(9)12/h1-2H,3,7H2,(H,8,10) |
| InChIKey | GVGAQZDNPZWHHD-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|