About [(2R)-tridec-10-en-2-yl] acetate
[(2R)-tridec-10-en-2-yl] acetate (PubChem CID 173369884) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is [(2R)-tridec-10-en-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R)-tridec-10-en-2-yl] acetate |
| PubChem CID | 173369884 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | [(2R)-tridec-10-en-2-yl] acetate |
| SMILES | CCC=CCCCCCCC[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-14(2)17-15(3)16/h5-6,14H,4,7-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | ODYRZHQNAYMELI-CQSZACIVSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-tridec-10-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-tridec-10-en-2-yl] acetate?
The IUPAC name of [(2R)-tridec-10-en-2-yl] acetate (CID 173369884) is [(2R)-tridec-10-en-2-yl] acetate.
What is the SMILES notation for [(2R)-tridec-10-en-2-yl] acetate?
The canonical SMILES for [(2R)-tridec-10-en-2-yl] acetate is CCC=CCCCCCCC[C@@H](C)OC(C)=O.
What is the InChIKey of [(2R)-tridec-10-en-2-yl] acetate?
The InChIKey is ODYRZHQNAYMELI-CQSZACIVSA-N. The full InChI is InChI=1S/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-14(2)17-15(3)16/h5-6,14H,4,7-13H2,1-3H3/t14-/m1/s1.
What are the key properties of [(2R)-tridec-10-en-2-yl] acetate?
[(2R)-tridec-10-en-2-yl] acetate has a molecular weight of 240.39 g/mol, XLogP of 4.63, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-tridec-10-en-2-yl] acetate is sourced from PubChem (CID 173369884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).