C16H30O — CID 173371776
3-(2,2-dimethylhex-3-en-3-yloxy)-2,2-dimethylhex-3-ene (PubChem CID 173371776) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 3-(2,2-dimethylhex-3-en-3-yloxy)-2,2-dimethylhex-3-ene.
| Compound Name | 3-(2,2-dimethylhex-3-en-3-yloxy)-2,2-dimethylhex-3-ene |
|---|---|
| PubChem CID | 173371776 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 3-(2,2-dimethylhex-3-en-3-yloxy)-2,2-dimethylhex-3-ene |
| SMILES | CCC=C(OC(=CCC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H30O/c1-9-11-13(15(3,4)5)17-14(12-10-2)16(6,7)8/h11-12H,9-10H2,1-8H3 |
| InChIKey | OXRDSPMLAYEIDU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|