C9H20O4PSi+ — CID 173373991
(3-dimethylsilyloxy-4,4-dimethylpent-1-en-3-yl)oxy-hydroxy-oxophosphanium (PubChem CID 173373991) has the molecular formula C9H20O4PSi+ and a molecular weight of 251.31 g/mol. Its IUPAC name is (3-dimethylsilyloxy-4,4-dimethylpent-1-en-3-yl)oxy-hydroxy-oxophosphanium.
| Compound Name | (3-dimethylsilyloxy-4,4-dimethylpent-1-en-3-yl)oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 173373991 |
| Molecular Formula | C9H20O4PSi+ |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (3-dimethylsilyloxy-4,4-dimethylpent-1-en-3-yl)oxy-hydroxy-oxophosphanium |
| SMILES | C=CC(O[SiH](C)C)(O[P+](=O)O)C(C)(C)C |
| InChI | InChI=1S/C9H19O4PSi/c1-7-9(8(2,3)4,12-14(10)11)13-15(5)6/h7,15H,1H2,2-6H3/p+1 |
| InChIKey | WWLLVQWHLZWPEM-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|