About acetylene;ethenoxy-hydroxy-oxophosphanium
acetylene;ethenoxy-hydroxy-oxophosphanium (PubChem CID 175157956) has the molecular formula C6H8O3P+
and a molecular weight of 159.10 g/mol. Its IUPAC name is acetylene;ethenoxy-hydroxy-oxophosphanium.
Molecular Properties
| Compound Name | acetylene;ethenoxy-hydroxy-oxophosphanium |
| PubChem CID | 175157956 |
| Molecular Formula | C6H8O3P+ |
| Molecular Weight | 159.10 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | acetylene;ethenoxy-hydroxy-oxophosphanium |
| SMILES | C#C.C#C.C=CO[P+](=O)O |
| InChI | InChI=1S/C2H3O3P.2C2H2/c1-2-5-6(3)4;2*1-2/h2H,1H2;2*1-2H/p+1 |
| InChIKey | WPCLTMMQAFMYCP-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.10 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethenoxy-hydroxy-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethenoxy-hydroxy-oxophosphanium?
The IUPAC name of acetylene;ethenoxy-hydroxy-oxophosphanium (CID 175157956) is acetylene;ethenoxy-hydroxy-oxophosphanium.
What is the SMILES notation for acetylene;ethenoxy-hydroxy-oxophosphanium?
The canonical SMILES for acetylene;ethenoxy-hydroxy-oxophosphanium is C#C.C#C.C=CO[P+](=O)O.
What is the InChIKey of acetylene;ethenoxy-hydroxy-oxophosphanium?
The InChIKey is WPCLTMMQAFMYCP-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H3O3P.2C2H2/c1-2-5-6(3)4;2*1-2/h2H,1H2;2*1-2H/p+1.
What are the key properties of acetylene;ethenoxy-hydroxy-oxophosphanium?
acetylene;ethenoxy-hydroxy-oxophosphanium has a molecular weight of 159.10 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethenoxy-hydroxy-oxophosphanium is sourced from PubChem (CID 175157956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).