C6H11NO3P+ — CID 87568858
N,N-bis(ethenyl)ethenamine;dihydroxy(oxo)phosphanium (PubChem CID 87568858) has the molecular formula C6H11NO3P+ and a molecular weight of 176.13 g/mol. Its IUPAC name is N,N-bis(ethenyl)ethenamine;dihydroxy(oxo)phosphanium.
| Compound Name | N,N-bis(ethenyl)ethenamine;dihydroxy(oxo)phosphanium |
|---|---|
| PubChem CID | 87568858 |
| Molecular Formula | C6H11NO3P+ |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | N,N-bis(ethenyl)ethenamine;dihydroxy(oxo)phosphanium |
| SMILES | C=CN(C=C)C=C.O=[P+](O)O |
| InChI | InChI=1S/C6H9N.HO3P/c1-4-7(5-2)6-3;1-4(2)3/h4-6H,1-3H2;(H-,1,2,3)/p+1 |
| InChIKey | GWSGKUIYHATWKI-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|