C18H22F3NO6 — CID 173374380
diethyl 3-benzylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)pentanedioate;hydrate (PubChem CID 173374380) has the molecular formula C18H22F3NO6 and a molecular weight of 405.37 g/mol. Its IUPAC name is diethyl 3-benzylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)pentanedioate;hydrate.
| Compound Name | diethyl 3-benzylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)pentanedioate;hydrate |
|---|---|
| PubChem CID | 173374380 |
| Molecular Formula | C18H22F3NO6 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | diethyl 3-benzylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)pentanedioate;hydrate |
| SMILES | CCOC(=O)C/C(=N\Cc1ccccc1)C(C(=O)OCC)=C(O)C(F)(F)F.O |
| InChI | InChI=1S/C18H20F3NO5.H2O/c1-3-26-14(23)10-13(22-11-12-8-6-5-7-9-12)15(17(25)27-4-2)16(24)18(19,20)21;/h5-9,24H,3-4,10-11H2,1-2H3;1H2/b16-15?,22-13+; |
| InChIKey | YITBBCXWUGFBGL-FBCCSBDMSA-N |
| XLogP | 2.69 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|