C9H8Cl5N3O2P+ — CID 173376937
trichloro-[[1,3-dichloro-3-(4-nitrophenyl)propyl]diazenyl]phosphanium (PubChem CID 173376937) has the molecular formula C9H8Cl5N3O2P+ and a molecular weight of 398.42 g/mol. Its IUPAC name is trichloro-[[1,3-dichloro-3-(4-nitrophenyl)propyl]diazenyl]phosphanium.
| Compound Name | trichloro-[[1,3-dichloro-3-(4-nitrophenyl)propyl]diazenyl]phosphanium |
|---|---|
| PubChem CID | 173376937 |
| Molecular Formula | C9H8Cl5N3O2P+ |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 395.88 |
| IUPAC Name | trichloro-[[1,3-dichloro-3-(4-nitrophenyl)propyl]diazenyl]phosphanium |
| SMILES | O=[N+]([O-])c1ccc(C(Cl)CC(Cl)N=N[P+](Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C9H8Cl5N3O2P/c10-8(5-9(11)15-16-20(12,13)14)6-1-3-7(4-2-6)17(18)19/h1-4,8-9H,5H2/q+1 |
| InChIKey | XYTIWGQYBOOSNB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|