C9H13Cl2N2O5P — CID 67945283
aminophosphonic acid;1-(1,3-dichloropropyl)-4-nitrobenzene (PubChem CID 67945283) has the molecular formula C9H13Cl2N2O5P and a molecular weight of 331.09 g/mol. Its IUPAC name is aminophosphonic acid;1-(1,3-dichloropropyl)-4-nitrobenzene.
| Compound Name | aminophosphonic acid;1-(1,3-dichloropropyl)-4-nitrobenzene |
|---|---|
| PubChem CID | 67945283 |
| Molecular Formula | C9H13Cl2N2O5P |
| Molecular Weight | 331.09 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | aminophosphonic acid;1-(1,3-dichloropropyl)-4-nitrobenzene |
| SMILES | NP(=O)(O)O.O=[N+]([O-])c1ccc(C(Cl)CCCl)cc1 |
| InChI | InChI=1S/C9H9Cl2NO2.H4NO3P/c10-6-5-9(11)7-1-3-8(4-2-7)12(13)14;1-5(2,3)4/h1-4,9H,5-6H2;(H4,1,2,3,4) |
| InChIKey | XXCGIDYTYQAODS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.09 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|