C9H12ClN2O7P — CID 88528482
[[1-chloro-3-hydroxy-1-(4-nitrophenyl)propan-2-yl]amino] dihydrogen phosphate (PubChem CID 88528482) has the molecular formula C9H12ClN2O7P and a molecular weight of 326.63 g/mol. Its IUPAC name is [[1-chloro-3-hydroxy-1-(4-nitrophenyl)propan-2-yl]amino] dihydrogen phosphate.
| Compound Name | [[1-chloro-3-hydroxy-1-(4-nitrophenyl)propan-2-yl]amino] dihydrogen phosphate |
|---|---|
| PubChem CID | 88528482 |
| Molecular Formula | C9H12ClN2O7P |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | [[1-chloro-3-hydroxy-1-(4-nitrophenyl)propan-2-yl]amino] dihydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccc(C(Cl)C(CO)NOP(=O)(O)O)cc1 |
| InChI | InChI=1S/C9H12ClN2O7P/c10-9(8(5-13)11-19-20(16,17)18)6-1-3-7(4-2-6)12(14)15/h1-4,8-9,11,13H,5H2,(H2,16,17,18) |
| InChIKey | TXKCNIOMEBUIDB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|