C21H22N2O2 — CID 17337826
N-(2-adamantylideneamino)-2-hydroxynaphthalene-1-carboxamide (PubChem CID 17337826) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(2-adamantylideneamino)-2-hydroxynaphthalene-1-carboxamide.
| Compound Name | N-(2-adamantylideneamino)-2-hydroxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 17337826 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-(2-adamantylideneamino)-2-hydroxynaphthalene-1-carboxamide |
| SMILES | O=C(NN=C1C2CC3CC(C2)CC1C3)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O2/c24-18-6-5-14-3-1-2-4-17(14)19(18)21(25)23-22-20-15-8-12-7-13(10-15)11-16(20)9-12/h1-6,12-13,15-16,24H,7-11H2,(H,23,25)/b22-20- |
| InChIKey | XXPNGLFILNINCB-XDOYNYLZSA-N |
| XLogP | 4.09 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|