C19H34O4Si — CID 173378295
2-O'-(3-dimethylsilylpropyl) 2-O-propyl 5,6-dimethylbicyclo[2.2.1]heptane-2,2-dicarboxylate (PubChem CID 173378295) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is 2-O'-(3-dimethylsilylpropyl) 2-O-propyl 5,6-dimethylbicyclo[2.2.1]heptane-2,2-dicarboxylate.
| Compound Name | 2-O'-(3-dimethylsilylpropyl) 2-O-propyl 5,6-dimethylbicyclo[2.2.1]heptane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 173378295 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-O'-(3-dimethylsilylpropyl) 2-O-propyl 5,6-dimethylbicyclo[2.2.1]heptane-2,2-dicarboxylate |
| SMILES | CCCOC(=O)C1(C(=O)OCCC[SiH](C)C)CC2CC1C(C)C2C |
| InChI | InChI=1S/C19H34O4Si/c1-6-8-22-17(20)19(18(21)23-9-7-10-24(4)5)12-15-11-16(19)14(3)13(15)2/h13-16,24H,6-12H2,1-5H3 |
| InChIKey | NNUOFYPETBPNMR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|