C19H29N3O5 — CID 173378553
2-methyl-2-[[6-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]propanoic acid (PubChem CID 173378553) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-methyl-2-[[6-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]propanoic acid.
| Compound Name | 2-methyl-2-[[6-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 173378553 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-methyl-2-[[6-[3-[1-(2-methylpropoxy)ethoxyamino]-3-oxoprop-1-enyl]-3-pyridinyl]methylamino]propanoic acid |
| SMILES | CC(C)COC(C)ONC(=O)C=Cc1ccc(CNC(C)(C)C(=O)O)cn1 |
| InChI | InChI=1S/C19H29N3O5/c1-13(2)12-26-14(3)27-22-17(23)9-8-16-7-6-15(10-20-16)11-21-19(4,5)18(24)25/h6-10,13-14,21H,11-12H2,1-5H3,(H,22,23)(H,24,25) |
| InChIKey | QIQPWZPIOLDADO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|