C13H18N4O4 — CID 123548557
[[6-[3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino] 2-amino-2-methylpropanoate (PubChem CID 123548557) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is [[6-[3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino] 2-amino-2-methylpropanoate.
| Compound Name | [[6-[3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino] 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 123548557 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [[6-[3-(hydroxyamino)-3-oxoprop-1-enyl]-3-pyridinyl]methylamino] 2-amino-2-methylpropanoate |
| SMILES | CC(C)(N)C(=O)ONCc1ccc(C=CC(=O)NO)nc1 |
| InChI | InChI=1S/C13H18N4O4/c1-13(2,14)12(19)21-16-8-9-3-4-10(15-7-9)5-6-11(18)17-20/h3-7,16,20H,8,14H2,1-2H3,(H,17,18) |
| InChIKey | SNVDPJPZJJSWBI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|