C27H21BrO2 — CID 173379623
4-[(4-bromophenyl)-(4-phenacylphenyl)methyl]cyclohexa-2,4-dien-1-one (PubChem CID 173379623) has the molecular formula C27H21BrO2 and a molecular weight of 457.37 g/mol. Its IUPAC name is 4-[(4-bromophenyl)-(4-phenacylphenyl)methyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 4-[(4-bromophenyl)-(4-phenacylphenyl)methyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 173379623 |
| Molecular Formula | C27H21BrO2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 4-[(4-bromophenyl)-(4-phenacylphenyl)methyl]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(C(c2ccc(Br)cc2)c2ccc(CC(=O)c3ccccc3)cc2)=CC1 |
| InChI | InChI=1S/C27H21BrO2/c28-24-14-10-22(11-15-24)27(23-12-16-25(29)17-13-23)21-8-6-19(7-9-21)18-26(30)20-4-2-1-3-5-20/h1-16,27H,17-18H2 |
| InChIKey | HWKMNIPMLDHUPF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |