About 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]
5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] (PubChem CID 173380787) has the molecular formula C17H20
and a molecular weight of 224.35 g/mol. Its IUPAC name is 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene].
Molecular Properties
| Compound Name | 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] |
| PubChem CID | 173380787 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] |
| SMILES | Cc1cccc2c1C1(CCC2)CC2=CCC1C2 |
| InChI | InChI=1S/C17H20/c1-12-4-2-5-14-6-3-9-17(16(12)14)11-13-7-8-15(17)10-13/h2,4-5,7,15H,3,6,8-11H2,1H3 |
| InChIKey | NZHZPYSJJRPIIX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]?
The IUPAC name of 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] (CID 173380787) is 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene].
What is the SMILES notation for 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]?
The canonical SMILES for 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] is Cc1cccc2c1C1(CCC2)CC2=CCC1C2.
What is the InChIKey of 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]?
The InChIKey is NZHZPYSJJRPIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20/c1-12-4-2-5-14-6-3-9-17(16(12)14)11-13-7-8-15(17)10-13/h2,4-5,7,15H,3,6,8-11H2,1H3.
What are the key properties of 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene]?
5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] has a molecular weight of 224.35 g/mol, XLogP of 4.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylspiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] is sourced from PubChem (CID 173380787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).