C16H17Cl — CID 67993476
7-chlorospiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] (PubChem CID 67993476) has the molecular formula C16H17Cl and a molecular weight of 244.76 g/mol. Its IUPAC name is 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene].
| Compound Name | 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] |
|---|---|
| PubChem CID | 67993476 |
| Molecular Formula | C16H17Cl |
| Molecular Weight | 244.76 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-1-ene] |
| SMILES | Clc1ccc2c(c1)CCCC21CC2=CCC1C2 |
| InChI | InChI=1S/C16H17Cl/c17-14-5-6-15-12(9-14)2-1-7-16(15)10-11-3-4-13(16)8-11/h3,5-6,9,13H,1-2,4,7-8,10H2 |
| InChIKey | AKBCVJVPKPGKNZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|