C20H21N — CID 67993750
spiro[7,8-dihydro-6H-anthracene-5,5'-bicyclo[2.2.1]hept-1-ene]-1-amine (PubChem CID 67993750) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is spiro[7,8-dihydro-6H-anthracene-5,5'-bicyclo[2.2.1]hept-1-ene]-1-amine.
| Compound Name | spiro[7,8-dihydro-6H-anthracene-5,5'-bicyclo[2.2.1]hept-1-ene]-1-amine |
|---|---|
| PubChem CID | 67993750 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | spiro[7,8-dihydro-6H-anthracene-5,5'-bicyclo[2.2.1]hept-1-ene]-1-amine |
| SMILES | Nc1cccc2cc3c(cc12)CCCC31CC2=CCC1C2 |
| InChI | InChI=1S/C20H21N/c21-19-5-1-3-14-11-18-15(10-17(14)19)4-2-8-20(18)12-13-6-7-16(20)9-13/h1,3,5-6,10-11,16H,2,4,7-9,12,21H2 |
| InChIKey | HEIIEZBCOCKUQH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|