C41H41N3O7P2 — CID 173381620
1-[(2E)-2-ethylidene-4-methylpent-3-enyl]-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 173381620) has the molecular formula C41H41N3O7P2 and a molecular weight of 749.74 g/mol. Its IUPAC name is 1-[(2E)-2-ethylidene-4-methylpent-3-enyl]-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(2E)-2-ethylidene-4-methylpent-3-enyl]-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 173381620 |
| Molecular Formula | C41H41N3O7P2 |
| Molecular Weight | 749.74 g/mol |
| Exact Mass | 749.24 |
| IUPAC Name | 1-[(2E)-2-ethylidene-4-methylpent-3-enyl]-3,5-bis[2-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C/C=C(\C=C(C)C)Cn1c(=O)n(CC(C)P2(=O)Oc3ccccc3-c3ccccc32)c(=O)n(CC(C)P2(=O)Oc3ccccc3-c3ccccc32)c1=O |
| InChI | InChI=1S/C41H41N3O7P2/c1-6-30(23-27(2)3)26-44-40(46)42(24-28(4)52(48)37-21-13-9-17-33(37)31-15-7-11-19-35(31)50-52)39(45)43(41(44)47)25-29(5)53(49)38-22-14-10-18-34(38)32-16-8-12-20-36(32)51-53/h6-23,28-29H,24-26H2,1-5H3/b30-6+ |
| InChIKey | PDZUPVNSMMEYDG-KSJARQFSSA-N |
| XLogP | 7.19 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.74 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|