C20H21O2P — CID 139231830
6-(3,5-dimethylhexa-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 139231830) has the molecular formula C20H21O2P and a molecular weight of 324.36 g/mol. Its IUPAC name is 6-(3,5-dimethylhexa-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-(3,5-dimethylhexa-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 139231830 |
| Molecular Formula | C20H21O2P |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-(3,5-dimethylhexa-1,2-dienyl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CC(=C=CP1(=O)Oc2ccccc2-c2ccccc21)CC(C)C |
| InChI | InChI=1S/C20H21O2P/c1-15(2)14-16(3)12-13-23(21)20-11-7-5-9-18(20)17-8-4-6-10-19(17)22-23/h4-11,13,15H,14H2,1-3H3 |
| InChIKey | YULHOMAUFXGLLK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|